Difference between revisions of "3-HYDROXY-PROPIONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18390 == * common-name: ** 1-palmitoyl-2-myristoyl phosphatidate * smiles: ** cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(cccccccccc...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-PROPIONYL-COA == * common-name: ** 3-hydroxypropanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18390 ==
+
== Metabolite 3-HYDROXY-PROPIONYL-COA ==
 
* common-name:
 
* common-name:
** 1-palmitoyl-2-myristoyl phosphatidate
+
** 3-hydroxypropanoyl-coa
 
* smiles:
 
* smiles:
** cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccc)=o
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** gloxzzhezykxnv-wjokgbtcsa-l
+
** berbfzcusmqabm-iexphmlfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 618.83
+
** 835.566
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[HICH]]
 +
* [[RXN-6383]]
 +
* [[RXN-6384]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17023]]
+
* [[RXN-6383]]
* [[RXN-17024]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-palmitoyl-2-myristoyl phosphatidate}}
+
{{#set: common-name=3-hydroxypropanoyl-coa}}
{{#set: inchi-key=inchikey=gloxzzhezykxnv-wjokgbtcsa-l}}
+
{{#set: inchi-key=inchikey=berbfzcusmqabm-iexphmlfsa-j}}
{{#set: molecular-weight=618.83}}
+
{{#set: molecular-weight=835.566}}

Latest revision as of 11:12, 18 March 2021

Metabolite 3-HYDROXY-PROPIONYL-COA

  • common-name:
    • 3-hydroxypropanoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • berbfzcusmqabm-iexphmlfsa-j
  • molecular-weight:
    • 835.566

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality