Difference between revisions of "3-HYDROXY-PROPIONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02704 == * transcription-direction: ** negative * right-end-position: ** 75071 * left-end-position: ** 71340 * centisome-position: ** 54.96614...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-PROPIONYL-COA == * common-name: ** 3-hydroxypropanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ02704 ==
+
== Metabolite 3-HYDROXY-PROPIONYL-COA ==
* transcription-direction:
+
* common-name:
** negative
+
** 3-hydroxypropanoyl-coa
* right-end-position:
+
* smiles:
** 75071
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 71340
+
** berbfzcusmqabm-iexphmlfsa-j
* centisome-position:
+
* molecular-weight:
** 54.96614   
+
** 835.566
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[HICH]]
== Reaction(s) associated ==
+
* [[RXN-6383]]
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN-6384]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-6383]]
{{#set: transcription-direction=negative}}
+
== Reaction(s) of unknown directionality ==
{{#set: right-end-position=75071}}
+
{{#set: common-name=3-hydroxypropanoyl-coa}}
{{#set: left-end-position=71340}}
+
{{#set: inchi-key=inchikey=berbfzcusmqabm-iexphmlfsa-j}}
{{#set: centisome-position=54.96614    }}
+
{{#set: molecular-weight=835.566}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite 3-HYDROXY-PROPIONYL-COA

  • common-name:
    • 3-hydroxypropanoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • berbfzcusmqabm-iexphmlfsa-j
  • molecular-weight:
    • 835.566

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality