Difference between revisions of "3-HYDROXY-PROPIONYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20196 == * transcription-direction: ** positive * right-end-position: ** 74977 * left-end-position: ** 67311 * centisome-position: ** 31.855656...") |
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-PROPIONYL-COA == * common-name: ** 3-hydroxypropanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 3-HYDROXY-PROPIONYL-COA == |
− | * | + | * common-name: |
− | ** | + | ** 3-hydroxypropanoyl-coa |
− | + | * smiles: | |
− | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | * | + | * inchi-key: |
− | ** | + | ** berbfzcusmqabm-iexphmlfsa-j |
− | + | * molecular-weight: | |
− | + | ** 835.566 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[HICH]] | |
− | = | + | * [[RXN-6383]] |
− | + | * [[RXN-6384]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-6383]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=3-hydroxypropanoyl-coa}} | |
− | ** | + | {{#set: inchi-key=inchikey=berbfzcusmqabm-iexphmlfsa-j}} |
− | + | {{#set: molecular-weight=835.566}} | |
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | ** | ||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite 3-HYDROXY-PROPIONYL-COA
- common-name:
- 3-hydroxypropanoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- berbfzcusmqabm-iexphmlfsa-j
- molecular-weight:
- 835.566