Difference between revisions of "3-Oxo-5-Alpha-Steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-METHYL-CROTONYL-COA == * common-name: ** 3-methylcrotonyl-coa * smiles: ** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite 3-Oxo-5-Alpha-Steroids == * common-name: ** a 3-oxo-5-α-steroid == Reaction(s) known to consume the compound == * RXN-13682 ==...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-METHYL-CROTONYL-COA ==
+
== Metabolite 3-Oxo-5-Alpha-Steroids ==
 
* common-name:
 
* common-name:
** 3-methylcrotonyl-coa
+
** a 3-oxo-5-α-steroid
* smiles:
 
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
* inchi-key:
 
** bxipalatiynhjn-zmhdxicwsa-j
 
* molecular-weight:
 
** 845.604
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[RXN-13682]]
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 
* [[RXN-14264]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[1.3.99.5-RXN]]
* [[IVCDH]]
+
* [[RXN-13682]]
* [[RXN-11921]]
 
* [[RXN-14264]]
 
* [[RXN0-2301]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methylcrotonyl-coa}}
+
{{#set: common-name=a 3-oxo-5-α-steroid}}
{{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}}
 
{{#set: molecular-weight=845.604}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite 3-Oxo-5-Alpha-Steroids

  • common-name:
    • a 3-oxo-5-α-steroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality