Difference between revisions of "3-Oxo-5-Alpha-Steroids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04021 == * transcription-direction: ** negative * right-end-position: ** 20609 * left-end-position: ** 10856 * centisome-position: ** 9.618315...")
(Created page with "Category:metabolite == Metabolite CPD-11938 == * common-name: ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op(=o)(...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ04021 ==
+
== Metabolite CPD-11938 ==
* transcription-direction:
+
* common-name:
** negative
+
** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
* right-end-position:
+
* smiles:
** 20609
+
** c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
* left-end-position:
+
* inchi-key:
** 10856
+
** hhqooerqsfjgep-slwywoedsa-a
* centisome-position:
+
* molecular-weight:
** 9.618315   
+
** 805.885
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10965]]
== Reaction(s) associated ==
+
* [[RXN-10975]]
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[2.7.4.24-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-10965]]
{{#set: transcription-direction=negative}}
+
* [[RXN-10974]]
{{#set: right-end-position=20609}}
+
* [[RXN-10975]]
{{#set: left-end-position=10856}}
+
== Reaction(s) of unknown directionality ==
{{#set: centisome-position=9.618315    }}
+
{{#set: common-name=1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: inchi-key=inchikey=hhqooerqsfjgep-slwywoedsa-a}}
{{#set: nb reaction associated=1}}
+
{{#set: molecular-weight=805.885}}

Revision as of 20:33, 18 December 2020

Metabolite CPD-11938

  • common-name:
    • 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
  • smiles:
    • c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • hhqooerqsfjgep-slwywoedsa-a
  • molecular-weight:
    • 805.885

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality