Difference between revisions of "3-Oxo-5-Alpha-Steroids"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04021 == * transcription-direction: ** negative * right-end-position: ** 20609 * left-end-position: ** 10856 * centisome-position: ** 9.618315...") |
(Created page with "Category:metabolite == Metabolite CPD-11938 == * common-name: ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op(=o)(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-11938 == |
− | * | + | * common-name: |
− | ** | + | ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate |
− | * | + | * smiles: |
− | ** | + | ** c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1) |
− | * | + | * inchi-key: |
− | ** | + | ** hhqooerqsfjgep-slwywoedsa-a |
− | * | + | * molecular-weight: |
− | ** | + | ** 805.885 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-10965]] |
− | == Reaction(s) | + | * [[RXN-10975]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[2.7.4.24-RXN]] |
− | * | + | * [[RXN-10965]] |
− | {{#set: | + | * [[RXN-10974]] |
− | + | * [[RXN-10975]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=hhqooerqsfjgep-slwywoedsa-a}} |
− | + | {{#set: molecular-weight=805.885}} |
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-11938
- common-name:
- 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
- smiles:
- c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
- inchi-key:
- hhqooerqsfjgep-slwywoedsa-a
- molecular-weight:
- 805.885