Difference between revisions of "44-DIMETHYL-824-CHOLESTADIENOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSYL-P4 == * common-name: ** 5',5'''-diadenosine tetraphosphate * smiles: ** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(...")
(Created page with "Category:metabolite == Metabolite cis-D19-37-MOH-38-Me-C57-1-ACPs == * common-name: ** a cis-delta19-37-methoxy-38-methyl-c57:1-[acp] == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADENOSYL-P4 ==
+
== Metabolite cis-D19-37-MOH-38-Me-C57-1-ACPs ==
 
* common-name:
 
* common-name:
** 5',5'''-diadenosine tetraphosphate
+
** a cis-delta19-37-methoxy-38-methyl-c57:1-[acp]
* smiles:
 
** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
 
* inchi-key:
 
** yoahknvsncmzgq-xpwfqurosa-j
 
* molecular-weight:
 
** 832.36
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.1.41-RXN]]
+
* [[RXN1G-2544]]
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5',5'''-diadenosine tetraphosphate}}
+
{{#set: common-name=a cis-delta19-37-methoxy-38-methyl-c57:1-[acp]}}
{{#set: inchi-key=inchikey=yoahknvsncmzgq-xpwfqurosa-j}}
 
{{#set: molecular-weight=832.36}}
 

Revision as of 08:27, 15 March 2021

Metabolite cis-D19-37-MOH-38-Me-C57-1-ACPs

  • common-name:
    • a cis-delta19-37-methoxy-38-methyl-c57:1-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis-delta19-37-methoxy-38-methyl-c57:1-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.