Difference between revisions of "ADENOSYL-P4"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21688 == * transcription-direction: ** positive * right-end-position: ** 673314 * left-end-position: ** 651059 * centisome-position: ** 57.554363...") |
(Created page with "Category:metabolite == Metabolite ADENOSYL-P4 == * common-name: ** 5',5'''-diadenosine tetraphosphate * smiles: ** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite ADENOSYL-P4 == |
| − | * | + | * common-name: |
| − | ** | + | ** 5',5'''-diadenosine tetraphosphate |
| − | * | + | * smiles: |
| − | ** | + | ** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** yoahknvsncmzgq-xpwfqurosa-j |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 832.36 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[3.6.1.41-RXN]] |
| − | == Reaction(s) | + | * [[ATP-ADENYLYLTRANSFERASE-RXN]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[ATP-ADENYLYLTRANSFERASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=5',5'''-diadenosine tetraphosphate}} | |
| − | + | {{#set: inchi-key=inchikey=yoahknvsncmzgq-xpwfqurosa-j}} | |
| − | + | {{#set: molecular-weight=832.36}} | |
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite ADENOSYL-P4
- common-name:
- 5',5-diadenosine tetraphosphate
- smiles:
- c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
- inchi-key:
- yoahknvsncmzgq-xpwfqurosa-j
- molecular-weight:
- 832.36
