Difference between revisions of "ADENOSYL-P4"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Non-Glucur-Glucuronoside-Acceptors == * common-name: ** a non-glucuronated glucosyluronate acceptor == Reaction(s) known to consume the c...")
(Created page with "Category:metabolite == Metabolite CDP == * common-name: ** cdp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** zwiadyzpowu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Non-Glucur-Glucuronoside-Acceptors ==
+
== Metabolite CDP ==
 
* common-name:
 
* common-name:
** a non-glucuronated glucosyluronate acceptor
+
** cdp
 +
* smiles:
 +
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
 +
* inchi-key:
 +
** zwiadyzpowuwew-xvfcmesisa-k
 +
* molecular-weight:
 +
** 400.155
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
+
* [[ATCD]]
 +
* [[ATCDm]]
 +
* [[CDPKIN-RXN]]
 +
* [[CDPREDUCT-RXN]]
 +
* [[DCDT]]
 +
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
 +
* [[RXN-12198]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ATCM]]
 +
* [[DOLICHOL-KINASE-RXN]]
 +
* [[RXN-11832]]
 +
* [[RXN-12195]]
 +
* [[RXN-12959]]
 +
* [[RXN-15091]]
 +
* [[RXN-7683]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a non-glucuronated glucosyluronate acceptor}}
+
{{#set: common-name=cdp}}
 +
{{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}}
 +
{{#set: molecular-weight=400.155}}

Revision as of 14:56, 5 January 2021

Metabolite CDP

  • common-name:
    • cdp
  • smiles:
    • c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
  • inchi-key:
    • zwiadyzpowuwew-xvfcmesisa-k
  • molecular-weight:
    • 400.155

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality