Difference between revisions of "ALPHA-TOCOPHEROL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cerotoyl-ACPs == * common-name: ** a cerotoyl-[acp] == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...") |
(Created page with "Category:metabolite == Metabolite ALPHA-TOCOPHEROL == * common-name: ** α-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c)) * inch...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ALPHA-TOCOPHEROL == |
* common-name: | * common-name: | ||
− | ** | + | ** α-tocopherol |
+ | * smiles: | ||
+ | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c)) | ||
+ | * inchi-key: | ||
+ | ** gvjhhuawpyxkbd-ieosbipesa-n | ||
+ | * molecular-weight: | ||
+ | ** 430.713 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-tocopherol}} |
+ | {{#set: inchi-key=inchikey=gvjhhuawpyxkbd-ieosbipesa-n}} | ||
+ | {{#set: molecular-weight=430.713}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite ALPHA-TOCOPHEROL
- common-name:
- α-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c))
- inchi-key:
- gvjhhuawpyxkbd-ieosbipesa-n
- molecular-weight:
- 430.713