Difference between revisions of "AMINO-OXOBUT"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENYLOSUCC == * common-name: ** adenylo-succinate * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=nc=nc=23)nc(cc(=o)[o-])c(=...")
(Created page with "Category:metabolite == Metabolite AMINO-OXOBUT == * common-name: ** l-2-amino-3-oxobutanoate * smiles: ** cc(=o)c([n+])c([o-])=o * inchi-key: ** sauchdkdcuroao-vkhmyheasa-...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADENYLOSUCC ==
+
== Metabolite AMINO-OXOBUT ==
 
* common-name:
 
* common-name:
** adenylo-succinate
+
** l-2-amino-3-oxobutanoate
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=nc=nc=23)nc(cc(=o)[o-])c(=o)[o-])))
+
** cc(=o)c([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** ofbhppmpbojxrt-dpxqiynjsa-j
+
** sauchdkdcuroao-vkhmyheasa-n
 
* molecular-weight:
 
* molecular-weight:
** 459.265
+
** 117.104
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AAL_LPAREN_fum_RPAREN_]]
+
* [[AKBLIG-RXN]]
* [[AMPSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
* [[THREODEHYD-RXN]]
* [[AMPSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenylo-succinate}}
+
{{#set: common-name=l-2-amino-3-oxobutanoate}}
{{#set: inchi-key=inchikey=ofbhppmpbojxrt-dpxqiynjsa-j}}
+
{{#set: inchi-key=inchikey=sauchdkdcuroao-vkhmyheasa-n}}
{{#set: molecular-weight=459.265}}
+
{{#set: molecular-weight=117.104}}

Latest revision as of 11:11, 18 March 2021

Metabolite AMINO-OXOBUT

  • common-name:
    • l-2-amino-3-oxobutanoate
  • smiles:
    • cc(=o)c([n+])c([o-])=o
  • inchi-key:
    • sauchdkdcuroao-vkhmyheasa-n
  • molecular-weight:
    • 117.104

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality