Difference between revisions of "ANAGLYCOLYSIS-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] == * common-name: ** salicylate * smiles: ** c(c1(=cc=cc=c1o))([o-])=o * inchi...")
 
(Created page with "Category:pathway == Pathway ANAGLYCOLYSIS-PWY == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** glycolysis iii (from glucose) == Reaction(s) found == * 2PGADE...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] ==
+
== Pathway ANAGLYCOLYSIS-PWY ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** salicylate
+
** glycolysis iii (from glucose)
* smiles:
+
== Reaction(s) found ==
** c(c1(=cc=cc=c1o))([o-])=o
+
* [[2PGADEHYDRAT-RXN]]
* inchi-key:
+
* [[6PFRUCTPHOS-RXN]]
** ygsdefsmjlzeoe-uhfffaoysa-m
+
* [[F16ALDOLASE-RXN]]
* molecular-weight:
+
* [[GAPOXNPHOSPHN-RXN]]
** 137.115
+
* [[GLUCOKIN-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[PEPDEPHOS-RXN]]
* [[SALICYLATE-1-MONOOXYGENASE-RXN]]
+
* [[PGLUCISOM-RXN]]
== Reaction(s) known to produce the compound ==
+
* [[PHOSGLYPHOS-RXN]]
* [[RXNQT-4366]]
+
* [[RXN-15513]]
== Reaction(s) of unknown directionality ==
+
* [[TRIOSEPISOMERIZATION-RXN]]
{{#set: common-name=salicylate}}
+
== Reaction(s) not found ==
{{#set: inchi-key=inchikey=ygsdefsmjlzeoe-uhfffaoysa-m}}
+
* [None3PGAREARR-RXN 3PGAREARR-RXN]
{{#set: molecular-weight=137.115}}
+
{{#set: taxonomic-range=tax-2|tax-2759}}
 +
{{#set: common-name=glycolysis iii (from glucose)}}
 +
{{#set: nb reaction found=10}}
 +
{{#set: completion rate=0.91}}
 +
{{#set: nb total reaction=11}}

Latest revision as of 10:59, 18 March 2021

Pathway ANAGLYCOLYSIS-PWY

  • taxonomic-range:
    • tax-2759
    • tax-2
  • common-name:
    • glycolysis iii (from glucose)

Reaction(s) found

Reaction(s) not found

  • [None3PGAREARR-RXN 3PGAREARR-RXN]