Difference between revisions of "ANAGLYCOLYSIS-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] == * common-name: ** datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op...")
(Created page with "Category:pathway == Pathway ANAGLYCOLYSIS-PWY == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** glycolysis iii (from glucose) == Reaction(s) found == * 2PGADE...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] ==
+
== Pathway ANAGLYCOLYSIS-PWY ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** datp
+
** glycolysis iii (from glucose)
* smiles:
+
== Reaction(s) found ==
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
+
* [[2PGADEHYDRAT-RXN]]
* inchi-key:
+
* [[6PFRUCTPHOS-RXN]]
** suyvubyjarfzho-rrkcrqdmsa-j
+
* [[F16ALDOLASE-RXN]]
* molecular-weight:
+
* [[GAPOXNPHOSPHN-RXN]]
** 487.152
+
* [[GLUCOKIN-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[PEPDEPHOS-RXN]]
* [[DATCY]]
+
* [[PGLUCISOM-RXN]]
* [[DATPtm]]
+
* [[PHOSGLYPHOS-RXN]]
* [[DATUP]]
+
* [[RXN-15513]]
* [[RXN-14195]]
+
* [[TRIOSEPISOMERIZATION-RXN]]
* [[RXN-14214]]
+
== Reaction(s) not found ==
* [[RXN0-384]]
+
* [None3PGAREARR-RXN 3PGAREARR-RXN]
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-2|tax-2759}}
* [[DADPKIN-RXN]]
+
{{#set: common-name=glycolysis iii (from glucose)}}
* [[DATPtm]]
+
{{#set: nb reaction found=10}}
* [[NDPK]]
+
{{#set: completion rate=0.91}}
* [[NDPKm]]
+
{{#set: nb total reaction=11}}
* [[RXN-14192]]
 
* [[RXN0-745]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=datp}}
 
{{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}}
 
{{#set: molecular-weight=487.152}}
 

Latest revision as of 10:59, 18 March 2021

Pathway ANAGLYCOLYSIS-PWY

  • taxonomic-range:
    • tax-2759
    • tax-2
  • common-name:
    • glycolysis iii (from glucose)

Reaction(s) found

Reaction(s) not found

  • [None3PGAREARR-RXN 3PGAREARR-RXN]