Difference between revisions of "Apocytochromes-c"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MELIBIOSE == * common-name: ** melibiose * smiles: ** c(c1(oc(c(c(c1o)o)o)occ2(oc(c(c(c2o)o)o)o)))o * inchi-key: ** dlrvvldznnycbx-zzfzym...") |
(Created page with "Category:metabolite == Metabolite ACYL-ACP == * common-name: ** an acyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 1-ACYLGLYCEROL-3-P-ACYLT...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ACYL-ACP == |
* common-name: | * common-name: | ||
| − | ** | + | ** an acyl-[acyl-carrier protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]] |
| + | * [[1.3.1.9-RXN]] | ||
| + | * [[2.3.1.41-RXN]] | ||
| + | * [[RXN-10462]] | ||
| + | * [[RXN-16067]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.3.1.9-RXN]] | ||
| + | * [[2.3.1.41-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an acyl-[acyl-carrier protein]}} |
| − | |||
| − | |||
Revision as of 13:07, 14 January 2021
Contents
Metabolite ACYL-ACP
- common-name:
- an acyl-[acyl-carrier protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an acyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
