Difference between revisions of "CAFFEOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-674 == * common-name: ** trans-cinnamate * smiles: ** c(=o)([o-])c=cc1(=cc=cc=c1) * inchi-key: ** wbywaxjhaxsjni-votsokgwsa-m * molec...")
(Created page with "Category:metabolite == Metabolite CAFFEOYL-COA == * common-name: ** trans-caffeoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(o...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-674 ==
+
== Metabolite CAFFEOYL-COA ==
 
* common-name:
 
* common-name:
** trans-cinnamate
+
** trans-caffeoyl-coa
 
* smiles:
 
* smiles:
** c(=o)([o-])c=cc1(=cc=cc=c1)
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** wbywaxjhaxsjni-votsokgwsa-m
+
** qhrgjmimhclhrg-zseliehesa-j
 
* molecular-weight:
 
* molecular-weight:
** 147.153
+
** 925.647
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2001]]
+
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-1126]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-cinnamate}}
+
{{#set: common-name=trans-caffeoyl-coa}}
{{#set: inchi-key=inchikey=wbywaxjhaxsjni-votsokgwsa-m}}
+
{{#set: inchi-key=inchikey=qhrgjmimhclhrg-zseliehesa-j}}
{{#set: molecular-weight=147.153}}
+
{{#set: molecular-weight=925.647}}

Latest revision as of 11:17, 18 March 2021

Metabolite CAFFEOYL-COA

  • common-name:
    • trans-caffeoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • qhrgjmimhclhrg-zseliehesa-j
  • molecular-weight:
    • 925.647

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality