Difference between revisions of "CAFFEOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11373 RXN-11373] == * direction: ** left-to-right * common-name: ** diphthamide synthase ** dip...")
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-CHOLINE == * common-name: ** phosphocholine * smiles: ** c[n+](ccop([o-])([o-])=o)(c)c * inchi-key: ** yhhsonzfoiemcp-uhfffaoy...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11373 RXN-11373] ==
+
== Metabolite PHOSPHORYL-CHOLINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** diphthamide synthase
+
** phosphocholine
−
** diphthine synthase
+
* smiles:
−
== Reaction formula ==
+
** c[n+](ccop([o-])([o-])=o)(c)c
−
* 1 [[3-carboxy-3-dimethylammonio-propyl-L-his]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[DIPHTINE]][c] '''+''' 1 [[PROTON]][c]
+
* inchi-key:
−
== Gene(s) associated with this reaction  ==
+
** yhhsonzfoiemcp-uhfffaoysa-m
−
* Gene: [[SJ08595]]
+
* molecular-weight:
−
** Category: [[annotation]]
+
** 182.136
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to consume the compound ==
−
** Category: [[orthology]]
+
* [[2.7.7.15-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[CHLPCTDh]]
−
== Pathway(s) ==
+
* [[RXN-5647]]
−
== Reconstruction information  ==
+
* [[RXN-9614]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[CHOLINE-KINASE-RXN]]
−
== External links  ==
+
* [[PHOSPHOLIPASE-C-RXN]]
−
* RHEA:
+
* [[RXN-15212]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=36428 36428]
+
* [[RXN-9614]]
−
* LIGAND-RXN:
+
* [[SPHINGOMYELIN-PHOSPHODIESTERASE-RXN]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R08469 R08469]
+
== Reaction(s) of unknown directionality ==
−
{{#set: direction=left-to-right}}
+
{{#set: common-name=phosphocholine}}
−
{{#set: common-name=diphthine synthase|diphthamide synthase}}
+
{{#set: inchi-key=inchikey=yhhsonzfoiemcp-uhfffaoysa-m}}
−
{{#set: nb gene associated=1}}
+
{{#set: molecular-weight=182.136}}
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite PHOSPHORYL-CHOLINE

  • common-name:
    • phosphocholine
  • smiles:
    • c[n+](ccop([o-])([o-])=o)(c)c
  • inchi-key:
    • yhhsonzfoiemcp-uhfffaoysa-m
  • molecular-weight:
    • 182.136

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CAFFEOYL-COA&oldid=48294"