Difference between revisions of "CAFFEOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-CHOLINE == * common-name: ** phosphocholine * smiles: ** c[n+](ccop([o-])([o-])=o)(c)c * inchi-key: ** yhhsonzfoiemcp-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite tRNA-uridines == * common-name: ** a uridine in trna == Reaction(s) known to consume the compound == * RXN0-1281 == Reaction(s) known...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-uridines == |
* common-name: | * common-name: | ||
| − | ** | + | ** a uridine in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-1281]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a uridine in trna}} |
| − | |||
| − | |||
Revision as of 14:59, 5 January 2021
Contents
Metabolite tRNA-uridines
- common-name:
- a uridine in trna
