Difference between revisions of "CANAVANINOSUCCINATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11915 == * transcription-direction: ** positive * right-end-position: ** 425779 * left-end-position: ** 419860 * centisome-position: ** 54.293667...")
(Created page with "Category:metabolite == Metabolite CANAVANINOSUCCINATE == * common-name: ** canavaninosuccinate * smiles: ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o * inchi-k...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ11915 ==
+
== Metabolite CANAVANINOSUCCINATE ==
* transcription-direction:
+
* common-name:
** positive
+
** canavaninosuccinate
* right-end-position:
+
* smiles:
** 425779
+
** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o
* left-end-position:
+
* inchi-key:
** 419860
+
** sgymgugigtwwlu-rolxfiacsa-m
* centisome-position:
+
* molecular-weight:
** 54.293667   
+
** 291.24
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-22]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[RXN-5466]]
+
* [[RXN-10]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=canavaninosuccinate}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=sgymgugigtwwlu-rolxfiacsa-m}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=291.24}}
* [[RXN-5467]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-5468]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN-5469]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]]
 
** '''16''' reactions found over '''19''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=425779}}
 
{{#set: left-end-position=419860}}
 
{{#set: centisome-position=54.293667    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=4}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CANAVANINOSUCCINATE

  • common-name:
    • canavaninosuccinate
  • smiles:
    • c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o
  • inchi-key:
    • sgymgugigtwwlu-rolxfiacsa-m
  • molecular-weight:
    • 291.24

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality