Difference between revisions of "CANAVANINOSUCCINATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08721 == * transcription-direction: ** positive * right-end-position: ** 27862 * left-end-position: ** 371 * centisome-position: ** 0.7445613 =...") |
(Created page with "Category:metabolite == Metabolite CANAVANINOSUCCINATE == * common-name: ** canavaninosuccinate * smiles: ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o * inchi-k...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CANAVANINOSUCCINATE == |
| − | * | + | * common-name: |
| − | ** | + | ** canavaninosuccinate |
| − | * | + | * smiles: |
| − | ** | + | ** c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** sgymgugigtwwlu-rolxfiacsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 291.24 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-22]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-10]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=canavaninosuccinate}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=sgymgugigtwwlu-rolxfiacsa-m}} |
| − | {{#set: | + | {{#set: molecular-weight=291.24}} |
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CANAVANINOSUCCINATE
- common-name:
- canavaninosuccinate
- smiles:
- c(onc(=[n+])nc(cc(=o)[o-])c(=o)[o-])cc([n+])c([o-])=o
- inchi-key:
- sgymgugigtwwlu-rolxfiacsa-m
- molecular-weight:
- 291.24
