Difference between revisions of "CANAVANINOSUCCINATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9869 == * common-name: ** all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(...")
(Created page with "Category:metabolite == Metabolite 3-Hydroxy-Terminated-DNAs == * common-name: ** a [dna]-3'-hydroxyl == Reaction(s) known to consume the compound == * DNA-LIGASE-ATP-RXN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9869 ==
+
== Metabolite 3-Hydroxy-Terminated-DNAs ==
 
* common-name:
 
* common-name:
** all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol
+
** a [dna]-3'-hydroxyl
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
** lioknoijmjkvcg-rdsvhmiisa-n
 
* molecular-weight:
 
** 821.32
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9235]]
+
* [[DNA-LIGASE-ATP-RXN]]
 +
* [[DNA-LIGASE-NAD+-RXN]]
 +
* [[RXN-15712]]
 +
* [[RXN-15713]]
 +
* [[RXN-17919]]
 +
* [[RXN-17923]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol}}
+
{{#set: common-name=a [dna]-3'-hydroxyl}}
{{#set: inchi-key=inchikey=lioknoijmjkvcg-rdsvhmiisa-n}}
 
{{#set: molecular-weight=821.32}}
 

Revision as of 13:10, 14 January 2021

Metabolite 3-Hydroxy-Terminated-DNAs

  • common-name:
    • a [dna]-3'-hydroxyl

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [dna]-3'-hydroxyl" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.