Difference between revisions of "CDP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSYL-P4 == * common-name: ** 5',5'''-diadenosine tetraphosphate * smiles: ** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(...") |
(Created page with "Category:metabolite == Metabolite CPD-11671 == * common-name: ** 5-hydroxytryptophol * smiles: ** c(o)cc1(=cnc2(=c1c=c(o)c=c2)) * inchi-key: ** kqrohcsyogbqgj-uhfffaoysa-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11671 == |
* common-name: | * common-name: | ||
| − | ** 5 | + | ** 5-hydroxytryptophol |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(o)cc1(=cnc2(=c1c=c(o)c=c2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kqrohcsyogbqgj-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 177.202 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10782]] |
| − | * [[ | + | * [[RXN-10784]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10781]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=5 | + | {{#set: common-name=5-hydroxytryptophol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kqrohcsyogbqgj-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=177.202}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-11671
- common-name:
- 5-hydroxytryptophol
- smiles:
- c(o)cc1(=cnc2(=c1c=c(o)c=c2))
- inchi-key:
- kqrohcsyogbqgj-uhfffaoysa-n
- molecular-weight:
- 177.202
