Difference between revisions of "CDP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02966 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CDP == * common-name: ** cdp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** zwiadyzpowu...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CDP == |
− | == | + | * common-name: |
− | * | + | ** cdp |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o |
− | ** | + | * inchi-key: |
− | *** | + | ** zwiadyzpowuwew-xvfcmesisa-k |
− | * [[RXN- | + | * molecular-weight: |
− | ** | + | ** 400.155 |
− | * | + | == Reaction(s) known to consume the compound == |
− | == | + | * [[ATCD]] |
− | + | * [[ATCDm]] | |
− | + | * [[CDPKIN-RXN]] | |
− | {{#set: | + | * [[CDPREDUCT-RXN]] |
− | {{#set: | + | * [[DCDT]] |
− | {{#set: | + | * [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]] |
+ | * [[RXN-12198]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[ATCM]] | ||
+ | * [[DOLICHOL-KINASE-RXN]] | ||
+ | * [[RXN-11832]] | ||
+ | * [[RXN-12195]] | ||
+ | * [[RXN-12959]] | ||
+ | * [[RXN-15091]] | ||
+ | * [[RXN-7683]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=cdp}} | ||
+ | {{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}} | ||
+ | {{#set: molecular-weight=400.155}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CDP
- common-name:
- cdp
- smiles:
- c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
- inchi-key:
- zwiadyzpowuwew-xvfcmesisa-k
- molecular-weight:
- 400.155