Difference between revisions of "CDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Unsulfurated-Sulfur-Acceptors == * common-name: ** an unsulfurated [sulfur carrier] == Reaction(s) known to consume the compound == * R...")
(Created page with "Category:metabolite == Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE == * common-name: ** cis-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgx...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Unsulfurated-Sulfur-Acceptors ==
+
== Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE ==
 
* common-name:
 
* common-name:
** an unsulfurated [sulfur carrier]
+
** cis-dienelactone
 +
* smiles:
 +
** c1(=cc(=o)oc(=cc(=o)[o-])1)
 +
* inchi-key:
 +
** ayfxpgxazmfwnh-arjawskdsa-m
 +
* molecular-weight:
 +
** 139.087
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12587]]
+
* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
* [[RXN-12588]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.8.1.6-RXN]]
 
* [[RXN-12587]]
 
* [[RXN-14480]]
 
* [[RXN-14950]]
 
* [[RXN-14957]]
 
* [[RXN-14959]]
 
* [[RXN-17472]]
 
* [[RXN0-5063]]
 
* [[RXN0-6359]]
 
* [[RXN0-949]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an unsulfurated [sulfur carrier]}}
+
{{#set: common-name=cis-dienelactone}}
 +
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-arjawskdsa-m}}
 +
{{#set: molecular-weight=139.087}}

Revision as of 15:27, 5 January 2021

Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE

  • common-name:
    • cis-dienelactone
  • smiles:
    • c1(=cc(=o)oc(=cc(=o)[o-])1)
  • inchi-key:
    • ayfxpgxazmfwnh-arjawskdsa-m
  • molecular-weight:
    • 139.087

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality