Difference between revisions of "CDP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11523 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccc(o)...")
(Created page with "Category:metabolite == Metabolite CDP == * common-name: ** cdp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** zwiadyzpowu...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11523 ==
+
== Metabolite CDP ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa
+
** cdp
 
* smiles:
 
* smiles:
** ccc=ccc1(c(ccc(=o)1)cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
+
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** omdqviuydjawhx-qhzcmhftsa-j
+
** zwiadyzpowuwew-xvfcmesisa-k
 
* molecular-weight:
 
* molecular-weight:
** 1027.866
+
** 400.155
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10702]]
+
* [[ATCD]]
 +
* [[ATCDm]]
 +
* [[CDPKIN-RXN]]
 +
* [[CDPREDUCT-RXN]]
 +
* [[DCDT]]
 +
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
 +
* [[RXN-12198]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10704]]
+
* [[ATCM]]
 +
* [[DOLICHOL-KINASE-RXN]]
 +
* [[RXN-11832]]
 +
* [[RXN-12195]]
 +
* [[RXN-12959]]
 +
* [[RXN-15091]]
 +
* [[RXN-7683]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyhexanoyl)-coa}}
+
{{#set: common-name=cdp}}
{{#set: inchi-key=inchikey=omdqviuydjawhx-qhzcmhftsa-j}}
+
{{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}}
{{#set: molecular-weight=1027.866}}
+
{{#set: molecular-weight=400.155}}

Latest revision as of 11:13, 18 March 2021

Metabolite CDP

  • common-name:
    • cdp
  • smiles:
    • c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
  • inchi-key:
    • zwiadyzpowuwew-xvfcmesisa-k
  • molecular-weight:
    • 400.155

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality