Difference between revisions of "CPD-1099"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14159 == * common-name: ** 6''-o-carbamoylkanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)...")
(Created page with "Category:metabolite == Metabolite BENZALDEHYDE == * common-name: ** benzaldehyde * smiles: ** c(=o)c1(=cc=cc=c1) * inchi-key: ** humnylrzrppjdn-uhfffaoysa-n * molecular-we...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14159 ==
+
== Metabolite BENZALDEHYDE ==
 
* common-name:
 
* common-name:
** 6''-o-carbamoylkanamycin b
+
** benzaldehyde
 
* smiles:
 
* smiles:
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
+
** c(=o)c1(=cc=cc=c1)
 
* inchi-key:
 
* inchi-key:
** xcstznjiqfivpe-fqsmhnglsa-s
+
** humnylrzrppjdn-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 531.582
+
** 106.124
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14553]]
+
* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
* [[RXN-15287]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6''-o-carbamoylkanamycin b}}
+
{{#set: common-name=benzaldehyde}}
{{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}}
+
{{#set: inchi-key=inchikey=humnylrzrppjdn-uhfffaoysa-n}}
{{#set: molecular-weight=531.582}}
+
{{#set: molecular-weight=106.124}}

Revision as of 11:16, 15 January 2021

Metabolite BENZALDEHYDE

  • common-name:
    • benzaldehyde
  • smiles:
    • c(=o)c1(=cc=cc=c1)
  • inchi-key:
    • humnylrzrppjdn-uhfffaoysa-n
  • molecular-weight:
    • 106.124

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality