Difference between revisions of "CPD-1099"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09599 == * transcription-direction: ** negative * right-end-position: ** 22386 * left-end-position: ** 1702 * centisome-position: ** 4.377122 =...") |
(Created page with "Category:metabolite == Metabolite N1-METHYLADENINE == * common-name: ** n1-methyladenine * smiles: ** cn2(c=nc1(c(n=cn=1)=c(n)2)) * inchi-key: ** hpzmwtnatzpbih-uhfffaoysa...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite N1-METHYLADENINE == |
| − | * | + | * common-name: |
| − | ** | + | ** n1-methyladenine |
| − | * | + | * smiles: |
| − | ** | + | ** cn2(c=nc1(c(n=cn=1)=c(n)2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** hpzmwtnatzpbih-uhfffaoysa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 149.155 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN0-984]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=n1-methyladenine}} | |
| − | + | {{#set: inchi-key=inchikey=hpzmwtnatzpbih-uhfffaoysa-n}} | |
| − | == | + | {{#set: molecular-weight=149.155}} |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:33, 18 December 2020
Contents
Metabolite N1-METHYLADENINE
- common-name:
- n1-methyladenine
- smiles:
- cn2(c=nc1(c(n=cn=1)=c(n)2))
- inchi-key:
- hpzmwtnatzpbih-uhfffaoysa-n
- molecular-weight:
- 149.155
