Difference between revisions of "CPD-12365"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20926 == * transcription-direction: ** negative * right-end-position: ** 197260 * left-end-position: ** 194405 * centisome-position: ** 96.20248...")
 
(Created page with "Category:metabolite == Metabolite CPD-12365 == * common-name: ** 8-oxo-dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** aq...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ20926 ==
+
== Metabolite CPD-12365 ==
* transcription-direction:
+
* common-name:
** negative
+
** 8-oxo-dgmp
* right-end-position:
+
* smiles:
** 197260
+
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
* left-end-position:
+
* inchi-key:
** 194405
+
** aqivlflyhyfrku-vpeninkcsa-l
* centisome-position:
+
* molecular-weight:
** 96.20248   
+
** 361.207
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14205]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[RXN1F-19]]
+
* [[RXN-11396]]
** Category: [[annotation]]
+
* [[RXN-12816]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14205]]
== Pathway(s) associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-735]]
+
{{#set: common-name=8-oxo-dgmp}}
** '''16''' reactions found over '''19''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=aqivlflyhyfrku-vpeninkcsa-l}}
{{#set: transcription-direction=negative}}
+
{{#set: molecular-weight=361.207}}
{{#set: right-end-position=197260}}
 
{{#set: left-end-position=194405}}
 
{{#set: centisome-position=96.20248    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-12365

  • common-name:
    • 8-oxo-dgmp
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • aqivlflyhyfrku-vpeninkcsa-l
  • molecular-weight:
    • 361.207

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality