Difference between revisions of "CPD-13004"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-Fucopyranoses == * common-name: ** l-fucopyranose == Reaction(s) known to consume the compound == * FUCOKINASE-RXN == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite CPD-13004 == * common-name: ** angiotensin i * smiles: ** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13004 == |
* common-name: | * common-name: | ||
| − | ** | + | ** angiotensin i |
| + | * smiles: | ||
| + | ** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=o)=o)=o)cc3(c=cc=cc=3))=o)4))=o)=o)nc(c(cc5(c=cc(=cc=5)o))nc(c(c(c)c)nc(c(cccnc(=[n+])n)nc(c(cc(=o)[o-])[n+])=o)=o)=o)=o | ||
| + | * inchi-key: | ||
| + | ** orwyrwwvdcyomk-hbzpzaiksa-n | ||
| + | * molecular-weight: | ||
| + | ** 1296.491 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.4.23.15-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=angiotensin i}} |
| + | {{#set: inchi-key=inchikey=orwyrwwvdcyomk-hbzpzaiksa-n}} | ||
| + | {{#set: molecular-weight=1296.491}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-13004
- common-name:
- angiotensin i
- smiles:
- ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=o)=o)=o)cc3(c=cc=cc=3))=o)4))=o)=o)nc(c(cc5(c=cc(=cc=5)o))nc(c(c(c)c)nc(c(cccnc(=[n+])n)nc(c(cc(=o)[o-])[n+])=o)=o)=o)=o
- inchi-key:
- orwyrwwvdcyomk-hbzpzaiksa-n
- molecular-weight:
- 1296.491
