Difference between revisions of "CPD-13004"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20902 == * transcription-direction: ** negative * right-end-position: ** 593321 * left-end-position: ** 584350 * centisome-position: ** 95.71694...") |
(Created page with "Category:metabolite == Metabolite CPD-13004 == * common-name: ** angiotensin i * smiles: ** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-13004 == |
− | * | + | * common-name: |
− | ** | + | ** angiotensin i |
− | * | + | * smiles: |
− | ** | + | ** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=o)=o)=o)cc3(c=cc=cc=3))=o)4))=o)=o)nc(c(cc5(c=cc(=cc=5)o))nc(c(c(c)c)nc(c(cccnc(=[n+])n)nc(c(cc(=o)[o-])[n+])=o)=o)=o)=o |
− | * | + | * inchi-key: |
− | ** | + | ** orwyrwwvdcyomk-hbzpzaiksa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 1296.491 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[3.4.23.15-RXN]] |
− | * [[RXN | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=angiotensin i}} | |
− | + | {{#set: inchi-key=inchikey=orwyrwwvdcyomk-hbzpzaiksa-n}} | |
− | {{#set: | + | {{#set: molecular-weight=1296.491}} |
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-13004
- common-name:
- angiotensin i
- smiles:
- ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=o)=o)=o)cc3(c=cc=cc=3))=o)4))=o)=o)nc(c(cc5(c=cc(=cc=5)o))nc(c(c(c)c)nc(c(cccnc(=[n+])n)nc(c(cc(=o)[o-])[n+])=o)=o)=o)=o
- inchi-key:
- orwyrwwvdcyomk-hbzpzaiksa-n
- molecular-weight:
- 1296.491