Difference between revisions of "CPD-13004"

Revision as of 18:53, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-13378 ==
+== Metabolite CPD-24185 ==
-* common-name:
-** xllg xyloglucan oligosaccharide
-* smiles:
-** c9(c(c(c(c(occ8(oc(oc3(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)oc2(c(c(c(c(o2)co)o)o)o)))3)oc6(c(o)c(o)c(oc(coc4(c(c(c(co4)o)o)oc5(c(c(c(c(o5)co)o)o)o)))6)oc7(c(o)c(o)c(o)oc(co)7))))c(o)c(o)c(o)8))o9)o)o)o)
-* inchi-key:
-** gschigxdtvyeem-migiythbsa-n
-* molecular-weight:
-** 1387.215
 == Reaction(s) known to consume the compound ==
-* [[RXN-12400]]
+* [[RXN-22198]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-22206]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=xllg xyloglucan oligosaccharide}}
-{{#set: inchi-key=inchikey=gschigxdtvyeem-migiythbsa-n}}
-{{#set: molecular-weight=1387.215}}