Difference between revisions of "CPD-13004"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20902 == * transcription-direction: ** negative * right-end-position: ** 593321 * left-end-position: ** 584350 * centisome-position: ** 95.71694...")
(Created page with "Category:metabolite == Metabolite BILIVERDINE == * common-name: ** biliverdin-ix-α * smiles: ** c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o)...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ20902 ==
+
== Metabolite BILIVERDINE ==
* transcription-direction:
+
* common-name:
** negative
+
** biliverdin-ix-α
* right-end-position:
+
* smiles:
** 593321
+
** c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o))c(c)=c3ccc([o-])=o))n4)ccc([o-])=o))
* left-end-position:
+
* inchi-key:
** 584350
+
** qbuvfdktzjnupp-msgwkzgbsa-l
* centisome-position:
+
* molecular-weight:
** 95.71694   
+
** 580.639
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[1.3.7.2-RXN]]
== Reaction(s) associated ==
+
* [[1.3.7.4-RXN]]
* [[RXN-10745]]
+
* [[R05818]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
{{#set: transcription-direction=negative}}
+
* [[R05818]]
{{#set: right-end-position=593321}}
+
* [[RXN-17523]]
{{#set: left-end-position=584350}}
+
== Reaction(s) of unknown directionality ==
{{#set: centisome-position=95.71694    }}
+
{{#set: common-name=biliverdin-ix-α}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: inchi-key=inchikey=qbuvfdktzjnupp-msgwkzgbsa-l}}
{{#set: nb reaction associated=1}}
+
{{#set: molecular-weight=580.639}}

Revision as of 20:31, 18 December 2020

Metabolite BILIVERDINE

  • common-name:
    • biliverdin-ix-α
  • smiles:
    • c=cc1(c(nc(c(c)=1)=o)=cc4(=c(c)c(=c(c=c3(n=c(c=c2(c(c)=c(c=c)c(n2)=o))c(c)=c3ccc([o-])=o))n4)ccc([o-])=o))
  • inchi-key:
    • qbuvfdktzjnupp-msgwkzgbsa-l
  • molecular-weight:
    • 580.639

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality