Difference between revisions of "CPD-14282"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17050 == * common-name: ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)...")
(Created page with "Category:metabolite == Metabolite S-NORCOCLAURINE == * common-name: ** (s)-norcoclaurine * smiles: ** c1([n+][ch](c2(=c(c1)c=c(c(=c2)o)o))cc3(=cc=c(c=c3)o)) * inchi-key: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17050 ==
+
== Metabolite S-NORCOCLAURINE ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
+
** (s)-norcoclaurine
 
* smiles:
 
* smiles:
** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3)
+
** c1([n+][ch](c2(=c(c1)c=c(c(=c2)o)o))cc3(=cc=c(c=c3)o))
 
* inchi-key:
 
* inchi-key:
** poiijaagmgnxlo-vxgbxaggsa-n
+
** wzrcqwqrfzitdx-aweznqclsa-o
 
* molecular-weight:
 
* molecular-weight:
** 296.358
+
** 272.323
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.1.1.128-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15684]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=(s)-norcoclaurine}}
{{#set: inchi-key=inchikey=poiijaagmgnxlo-vxgbxaggsa-n}}
+
{{#set: inchi-key=inchikey=wzrcqwqrfzitdx-aweznqclsa-o}}
{{#set: molecular-weight=296.358}}
+
{{#set: molecular-weight=272.323}}

Revision as of 13:11, 14 January 2021

Metabolite S-NORCOCLAURINE

  • common-name:
    • (s)-norcoclaurine
  • smiles:
    • c1([n+][ch](c2(=c(c1)c=c(c(=c2)o)o))cc3(=cc=c(c=c3)o))
  • inchi-key:
    • wzrcqwqrfzitdx-aweznqclsa-o
  • molecular-weight:
    • 272.323

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality