Difference between revisions of "CPD-17050"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7163 RXN-7163] == * direction: ** left-to-right * common-name: ** inositol-1,3,4,5,6-pentakisph...") |
(Created page with "Category:metabolite == Metabolite CPD-17050 == * common-name: ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-17050 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine |
− | * | + | * smiles: |
− | ** | + | ** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3) |
− | == | + | * inchi-key: |
− | + | ** poiijaagmgnxlo-vxgbxaggsa-n | |
− | + | * molecular-weight: | |
− | * | + | ** 296.358 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-15684]] |
− | ** | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}} | |
− | + | {{#set: inchi-key=inchikey=poiijaagmgnxlo-vxgbxaggsa-n}} | |
− | + | {{#set: molecular-weight=296.358}} | |
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-17050
- common-name:
- 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
- smiles:
- c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3)
- inchi-key:
- poiijaagmgnxlo-vxgbxaggsa-n
- molecular-weight:
- 296.358