Difference between revisions of "CPD-17050"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7163 RXN-7163] == * direction: ** left-to-right * common-name: ** inositol-1,3,4,5,6-pentakisph...")
 
(Created page with "Category:metabolite == Metabolite CPD-17050 == * common-name: ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7163 RXN-7163] ==
+
== Metabolite CPD-17050 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** inositol-1,3,4,5,6-pentakisphosphate 2-kinase
+
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.7.1.158 ec-2.7.1.158]
+
** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3)
== Reaction formula ==
+
* inchi-key:
* 1 [[ATP]][c] '''+''' 1 [[CPD-1107]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[MI-HEXAKISPHOSPHATE]][c] '''+''' 1 [[PROTON]][c]
+
** poiijaagmgnxlo-vxgbxaggsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ21412]]
+
** 296.358
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
** Category: [[orthology]]
+
* [[RXN-15684]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
* Gene: [[SJ22245]]
+
{{#set: common-name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=poiijaagmgnxlo-vxgbxaggsa-n}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=296.358}}
== Pathway(s) ==
 
* [[PWY-6554]], 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554]
 
** '''5''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-4661]], 1D-myo-inositol hexakisphosphate biosynthesis III (Spirodela polyrrhiza): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4661 PWY-4661]
 
** '''3''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-6362]], 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6362 PWY-6362]
 
** '''5''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-6372]], 1D-myo-inositol hexakisphosphate biosynthesis IV (Dictyostelium): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6372 PWY-6372]
 
** '''3''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-6369]], inositol diphosphates biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6369 PWY-6369]
 
** '''8''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-6361]], 1D-myo-inositol hexakisphosphate biosynthesis I (from Ins(1,4,5)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6361 PWY-6361]
 
** '''5''' reactions found over '''5''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20314 20314]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R05202 R05202]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=inositol-1,3,4,5,6-pentakisphosphate 2-kinase}}
 
{{#set: ec-number=ec-2.7.1.158}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=6}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-17050

  • common-name:
    • 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
  • smiles:
    • c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3)
  • inchi-key:
    • poiijaagmgnxlo-vxgbxaggsa-n
  • molecular-weight:
    • 296.358

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality