Difference between revisions of "CPD-17050"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12258 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanine * smiles: ** cc(c(=o)nc(c(=o...")
(Created page with "Category:metabolite == Metabolite tRNA-guanosine18 == * common-name: ** a guanosine18 in trna == Reaction(s) known to consume the compound == * 2.1.1.34-RXN == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12258 ==
+
== Metabolite tRNA-guanosine18 ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanine
+
** a guanosine18 in trna
* smiles:
 
** cc(c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc[n+])c(nc(c)c(=o)[o-])=o)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op(op(occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)([o-])=o)
 
* inchi-key:
 
** foedsvrzgqixsp-xsoiktqosa-k
 
* molecular-weight:
 
** 1075.843
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11347]]
+
* [[2.1.1.34-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanine}}
+
{{#set: common-name=a guanosine18 in trna}}
{{#set: inchi-key=inchikey=foedsvrzgqixsp-xsoiktqosa-k}}
 
{{#set: molecular-weight=1075.843}}
 

Revision as of 15:28, 5 January 2021

Metabolite tRNA-guanosine18

  • common-name:
    • a guanosine18 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality