Difference between revisions of "CPD-19144"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13276 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...") |
(Created page with "Category:metabolite == Metabolite CPD-19144 == * common-name: ** (7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-19144 == |
− | == | + | * common-name: |
− | + | ** (7z)-hexadecenoyl-coa | |
− | = | + | * smiles: |
− | + | ** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | ** | + | * inchi-key: |
− | *** | + | ** mjwmoldkmbisob-ydggzukgsa-j |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 999.899 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-17779]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-17778]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=(7z)-hexadecenoyl-coa}} | ||
+ | {{#set: inchi-key=inchikey=mjwmoldkmbisob-ydggzukgsa-j}} | ||
+ | {{#set: molecular-weight=999.899}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-19144
- common-name:
- (7z)-hexadecenoyl-coa
- smiles:
- ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- mjwmoldkmbisob-ydggzukgsa-j
- molecular-weight:
- 999.899