Difference between revisions of "CPD-19144"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05959 == * transcription-direction: ** negative * right-end-position: ** 426452 * left-end-position: ** 381392 * centisome-position: ** 78.859795...")
 
(Created page with "Category:metabolite == Metabolite CPD-19144 == * common-name: ** (7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ05959 ==
+
== Metabolite CPD-19144 ==
* transcription-direction:
+
* common-name:
** negative
+
** (7z)-hexadecenoyl-coa
* right-end-position:
+
* smiles:
** 426452
+
** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 381392
+
** mjwmoldkmbisob-ydggzukgsa-j
* centisome-position:
+
* molecular-weight:
** 78.859795   
+
** 999.899
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17779]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[2.7.1.150-RXN]]
+
* [[RXN-17778]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(7z)-hexadecenoyl-coa}}
* [[2.7.1.68-RXN]]
+
{{#set: inchi-key=inchikey=mjwmoldkmbisob-ydggzukgsa-j}}
** Category: [[orthology]]
+
{{#set: molecular-weight=999.899}}
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-6352]]
 
** '''5''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY-6351]]
 
** '''4''' reactions found over '''5''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=426452}}
 
{{#set: left-end-position=381392}}
 
{{#set: centisome-position=78.859795    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-19144

  • common-name:
    • (7z)-hexadecenoyl-coa
  • smiles:
    • ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • mjwmoldkmbisob-ydggzukgsa-j
  • molecular-weight:
    • 999.899

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality