Difference between revisions of "CPD-19144"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19940 == * transcription-direction: ** positive * right-end-position: ** 37571 * left-end-position: ** 31742 * centisome-position: ** 14.59617...")
(Created page with "Category:metabolite == Metabolite CPD-12461 == * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ19940 ==
+
== Metabolite CPD-12461 ==
* transcription-direction:
+
* smiles:
** positive
+
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c
* right-end-position:
+
* common-name:
** 37571
+
** tri-trans,hepta-cis-undecaprenyl diphosphate
* left-end-position:
+
* molecular-weight:
** 31742
+
** 924.251
* centisome-position:
+
== Reaction(s) known to consume the compound ==
** 14.59617   
+
== Reaction(s) known to produce the compound ==
== Organism(s) associated with this gene  ==
+
* [[RXN-11488]]
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) associated ==
+
{{#set: common-name=tri-trans,hepta-cis-undecaprenyl diphosphate}}
* [[3.1.26.4-RXN]]
+
{{#set: molecular-weight=924.251}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=37571}}
 
{{#set: left-end-position=31742}}
 
{{#set: centisome-position=14.59617    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:30, 18 December 2020

Metabolite CPD-12461

  • smiles:
    • cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op([o-])([o-])=o)c)c)c
  • common-name:
    • tri-trans,hepta-cis-undecaprenyl diphosphate
  • molecular-weight:
    • 924.251

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality