Difference between revisions of "CPD-19147"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15054 == * transcription-direction: ** positive * right-end-position: ** 178240 * left-end-position: ** 174875 * centisome-position: ** 57.67607...")
(Created page with "Category:metabolite == Metabolite CPD-19147 == * common-name: ** (7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ15054 ==
+
== Metabolite CPD-19147 ==
* transcription-direction:
+
* common-name:
** positive
+
** (7z)-tetradecenoyl-coa
* right-end-position:
+
* smiles:
** 178240
+
** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 174875
+
** jpihvkickvpffy-twafkmgksa-j
* centisome-position:
+
* molecular-weight:
** 57.67607   
+
** 971.845
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17792]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
+
* [[RXN-17791]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(7z)-tetradecenoyl-coa}}
== Pathway(s) associated ==
+
{{#set: inchi-key=inchikey=jpihvkickvpffy-twafkmgksa-j}}
* [[PWY-6100]]
+
{{#set: molecular-weight=971.845}}
** '''3''' reactions found over '''4''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=178240}}
 
{{#set: left-end-position=174875}}
 
{{#set: centisome-position=57.67607    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-19147

  • common-name:
    • (7z)-tetradecenoyl-coa
  • smiles:
    • ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jpihvkickvpffy-twafkmgksa-j
  • molecular-weight:
    • 971.845

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality