Difference between revisions of "CPD-19147"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-TRYPTOPHAN == * common-name: ** 5-hydroxy-l-tryptophan * smiles: ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+])) * inchi-key: ** l...") |
(Created page with "Category:metabolite == Metabolite CPD-19147 == * common-name: ** (7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19147 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (7z)-tetradecenoyl-coa |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jpihvkickvpffy-twafkmgksa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 971.845 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17792]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17791]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(7z)-tetradecenoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jpihvkickvpffy-twafkmgksa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=971.845}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-19147
- common-name:
- (7z)-tetradecenoyl-coa
- smiles:
- ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- jpihvkickvpffy-twafkmgksa-j
- molecular-weight:
- 971.845
