Difference between revisions of "CPD-19147"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-TRYPTOPHAN == * common-name: ** 5-hydroxy-l-tryptophan * smiles: ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+])) * inchi-key: ** l...") |
(Created page with "Category:metabolite == Metabolite L-ALLO-THREONINE == * common-name: ** l-allo-threonine * smiles: ** cc(o)c([n+])c(=o)[o-] * inchi-key: ** ayfvyjqapqtccc-hrfvkafmsa-n * m...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-ALLO-THREONINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-allo-threonine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(o)c([n+])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ayfvyjqapqtccc-hrfvkafmsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 119.12 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[LTAA-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-allo-threonine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ayfvyjqapqtccc-hrfvkafmsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=119.12}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite L-ALLO-THREONINE
- common-name:
- l-allo-threonine
- smiles:
- cc(o)c([n+])c(=o)[o-]
- inchi-key:
- ayfvyjqapqtccc-hrfvkafmsa-n
- molecular-weight:
- 119.12
