Difference between revisions of "CPD-19150"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD66-29 == * common-name: ** 5-androstene-3,17-dione * smiles: ** cc24(ccc(=o)cc(=cc[ch]1([ch]3(ccc(=o)c(cc[ch]12)(c)3)))4) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-19150 == * common-name: ** (2e,5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-19150 == |
* common-name: | * common-name: | ||
− | ** | + | ** (2e,5z)-dodecenoyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** zsjrxhrcabosnc-shjpognxsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 941.776 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-17797]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-17796]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2e,5z)-dodecenoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zsjrxhrcabosnc-shjpognxsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=941.776}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-19150
- common-name:
- (2e,5z)-dodecenoyl-coa
- smiles:
- ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- zsjrxhrcabosnc-shjpognxsa-j
- molecular-weight:
- 941.776