Difference between revisions of "CPD-19150"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9897 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...") |
(Created page with "Category:metabolite == Metabolite CPD-10546 == * common-name: ** methyl (indol-3-yl)acetate * smiles: ** coc(=o)cc2(c1(c(=cc=cc=1)nc=2)) * inchi-key: ** kthadmdgdnyqrx-uhf...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-10546 == |
* common-name: | * common-name: | ||
| − | ** 3- | + | ** methyl (indol-3-yl)acetate |
* smiles: | * smiles: | ||
| − | ** | + | ** coc(=o)cc2(c1(c(=cc=cc=1)nc=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kthadmdgdnyqrx-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 189.213 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10711]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=3- | + | {{#set: common-name=methyl (indol-3-yl)acetate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kthadmdgdnyqrx-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=189.213}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite CPD-10546
- common-name:
- methyl (indol-3-yl)acetate
- smiles:
- coc(=o)cc2(c1(c(=cc=cc=1)nc=2))
- inchi-key:
- kthadmdgdnyqrx-uhfffaoysa-n
- molecular-weight:
- 189.213
