Difference between revisions of "CPD-19150"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03534 == * transcription-direction: ** positive * right-end-position: ** 98026 * left-end-position: ** 94964 * centisome-position: ** 79.56566...")
(Created page with "Category:metabolite == Metabolite CPD-19150 == * common-name: ** (2e,5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ03534 ==
+
== Metabolite CPD-19150 ==
* transcription-direction:
+
* common-name:
** positive
+
** (2e,5z)-dodecenoyl-coa
* right-end-position:
+
* smiles:
** 98026
+
** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 94964
+
** zsjrxhrcabosnc-shjpognxsa-j
* centisome-position:
+
* molecular-weight:
** 79.56566   
+
** 941.776
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17797]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[RXN-17796]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(2e,5z)-dodecenoyl-coa}}
{{#set: transcription-direction=positive}}
+
{{#set: inchi-key=inchikey=zsjrxhrcabosnc-shjpognxsa-j}}
{{#set: right-end-position=98026}}
+
{{#set: molecular-weight=941.776}}
{{#set: left-end-position=94964}}
 
{{#set: centisome-position=79.56566    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-19150

  • common-name:
    • (2e,5z)-dodecenoyl-coa
  • smiles:
    • ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zsjrxhrcabosnc-shjpognxsa-j
  • molecular-weight:
    • 941.776

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality