Difference between revisions of "CPD-19151"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Xyloglucans-Galactose-23 == * common-name: ** an xllg xylogulcan == Reaction(s) known to consume the compound == * RXN-9463 == Reacti...") |
(Created page with "Category:metabolite == Metabolite INDOLE_PYRUVATE == * common-name: ** (indol-3-yl)pyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** rstklpzezyg...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite INDOLE_PYRUVATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (indol-3-yl)pyruvate |
| + | * smiles: | ||
| + | ** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2)) | ||
| + | * inchi-key: | ||
| + | ** rstklpzezygqpy-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 202.189 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[RXNDQC-2]] |
| + | * [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(indol-3-yl)pyruvate}} |
| + | {{#set: inchi-key=inchikey=rstklpzezygqpy-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=202.189}} | ||
Revision as of 11:12, 15 January 2021
Contents
Metabolite INDOLE_PYRUVATE
- common-name:
- (indol-3-yl)pyruvate
- smiles:
- c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- rstklpzezygqpy-uhfffaoysa-m
- molecular-weight:
- 202.189
