Difference between revisions of "CPD-19161"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2189 == * common-name: ** 1-18:2-2-16:2-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...")
(Created page with "Category:metabolite == Metabolite D-mannopyranose == * common-name: ** d-mannopyranose == Reaction(s) known to consume the compound == * MANNKIN-RXN * MANNKIN-RXN-D-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-2189 ==
+
== Metabolite D-mannopyranose ==
 
* common-name:
 
* common-name:
** 1-18:2-2-16:2-monogalactosyldiacylglycerol
+
** d-mannopyranose
* smiles:
 
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
 
* inchi-key:
 
** djvqakqvqxihel-uilgywmgsa-n
 
* molecular-weight:
 
** 751.052
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8299]]
+
* [[MANNKIN-RXN]]
* [[RXN-8306]]
+
* [[MANNKIN-RXN-D-mannopyranose/ATP//MANNOSE-6P/ADP/PROTON.43.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13064]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-16:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=d-mannopyranose}}
{{#set: inchi-key=inchikey=djvqakqvqxihel-uilgywmgsa-n}}
 
{{#set: molecular-weight=751.052}}
 

Revision as of 08:31, 15 March 2021

Metabolite D-mannopyranose

  • common-name:
    • d-mannopyranose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality