Difference between revisions of "CPD-19161"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN] == * direction: ** left-...")
(Created page with "Category:metabolite == Metabolite FMN == * common-name: ** fmn * smiles: ** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3))) * inchi-key: *...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN] ==
+
== Metabolite FMN ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** trans-octaprenyltranstransferase
+
** fmn
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.5.1.84 ec-2.5.1.84]
+
** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
== Reaction formula ==
+
* inchi-key:
* 7 [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[GERANYL-PP]][c] '''=>''' 7 [[PPI]][c] '''+''' 1 [[SOLANESYL-PYROPHOSPHATE]][c]
+
** ankzybdxhmzbdk-scrdcrapsa-k
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ19255]]
+
** 453.324
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[FAD-PYROPHOSPHATASE-RXN]]
** Category: [[orthology]]
+
* [[FADSYN-RXN]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-9510]]
* Gene: [[SJ10418]]
+
* [[RXN0-5187]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[ARPT]]
== Pathway(s) ==
+
* [[FAD-PYROPHOSPHATASE-RXN]]
* [[PWY-5805]], nonaprenyl diphosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5805 PWY-5805]
+
* [[RIBOFLAVINKIN-RXN]]
** '''1''' reactions found over '''1''' reactions in the full pathway
+
* [[RXN-9510]]
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=fmn}}
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=ankzybdxhmzbdk-scrdcrapsa-k}}
== External links  ==
+
{{#set: molecular-weight=453.324}}
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11325 11325]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R09250 R09250]
 
** [http://www.genome.jp/dbget-bin/www_bget?R07267 R07267]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=trans-octaprenyltranstransferase}}
 
{{#set: ec-number=ec-2.5.1.84}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite FMN

  • common-name:
    • fmn
  • smiles:
    • cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
  • inchi-key:
    • ankzybdxhmzbdk-scrdcrapsa-k
  • molecular-weight:
    • 453.324

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality