Difference between revisions of "CPD-19169"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-5304 RXN3O-5304] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/E...")
(Created page with "Category:metabolite == Metabolite CPD-19169 == * common-name: ** 3-oxo-(9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-5304 RXN3O-5304] ==
+
== Metabolite CPD-19169 ==
* direction:
+
* common-name:
** left-to-right
+
** 3-oxo-(9z)-octadecenoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.3.1 ec-2.3.1]
+
** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
** [http://enzyme.expasy.org/EC/2.3.1.86 ec-2.3.1.86]
+
* inchi-key:
== Reaction formula ==
+
** aveyykdekgjvbu-bpmmelmssa-j
* 1 [[CO-A]][c] '''+''' 1 [[Stearoyl-ACPs]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[STEAROYL-COA]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 1041.936
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
* [[PWY3O-355]], stearate biosynthesis III (fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-355 PWY3O-355]
+
* [[RXN-17778]]
** '''6''' reactions found over '''6''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
== Reconstruction information  ==
+
* [[RXN-17777]]
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_medium]]; tool: [[meneco]]; comment: added for gapfilling
+
== Reaction(s) of unknown directionality ==
== External links  ==
+
{{#set: common-name=3-oxo-(9z)-octadecenoyl-coa}}
{{#set: direction=left-to-right}}
+
{{#set: inchi-key=inchikey=aveyykdekgjvbu-bpmmelmssa-j}}
{{#set: ec-number=ec-2.3.1|ec-2.3.1.86}}
+
{{#set: molecular-weight=1041.936}}
{{#set: nb gene associated=0}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=gap-filling}}
 
{{#set: reconstruction tool=meneco}}
 
{{#set: reconstruction comment=added for gapfilling}}
 
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_medium}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-19169

  • common-name:
    • 3-oxo-(9z)-octadecenoyl-coa
  • smiles:
    • ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • aveyykdekgjvbu-bpmmelmssa-j
  • molecular-weight:
    • 1041.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality