Difference between revisions of "CPD-19170"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04962 == * transcription-direction: ** positive * right-end-position: ** 347786 * left-end-position: ** 337319 * centisome-position: ** 34.93239...")
(Created page with "Category:metabolite == Metabolite CPD-19170 == * common-name: ** (2e,7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ04962 ==
+
== Metabolite CPD-19170 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (2e,7z)-hexadecenoyl-coa
−
* right-end-position:
+
* smiles:
−
** 347786
+
** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 337319
+
** yqarrkbgbkpbcx-dvzfgldusa-j
−
* centisome-position:
+
* molecular-weight:
−
** 34.93239   
+
** 997.883
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17780]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-12496]]
+
* [[RXN-17779]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(2e,7z)-hexadecenoyl-coa}}
−
* [[RXN1F-150]]
+
{{#set: inchi-key=inchikey=yqarrkbgbkpbcx-dvzfgldusa-j}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=997.883}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN1F-151]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7591]]
 
−
** '''1''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-7938]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7939]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-5943]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=347786}}
 
−
{{#set: left-end-position=337319}}
 
−
{{#set: centisome-position=34.93239    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-19170

  • common-name:
    • (2e,7z)-hexadecenoyl-coa
  • smiles:
    • ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • yqarrkbgbkpbcx-dvzfgldusa-j
  • molecular-weight:
    • 997.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-19170&oldid=136853"