Difference between revisions of "CPD-381"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GALACTOSE-1P == * common-name: ** α-d-galactose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite Cis-vaccenoyl-ACPs == * common-name: ** a cis-vaccenoyl-[acp] == Reaction(s) known to consume the compound == * RXN-17014 * RXN-170...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Cis-vaccenoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a cis-vaccenoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17014]] |
| − | * [[ | + | * [[RXN-17015]] |
| − | * [[ | + | * [[RXN-17016]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9558]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a cis-vaccenoyl-[acp]}} |
| − | |||
| − | |||
Revision as of 11:15, 15 January 2021
Contents
Metabolite Cis-vaccenoyl-ACPs
- common-name:
- a cis-vaccenoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a cis-vaccenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
