Difference between revisions of "CPD-381"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8088 == * common-name: ** 1-linoleoyl-2-oleoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop...")
(Created page with "Category:metabolite == Metabolite CPD-381 == * common-name: ** (s)-2-hydroxyglutarate * smiles: ** c(=o)([o-])c(o)ccc(=o)[o-] * inchi-key: ** hwxbtnavrsuojr-vkhmyheasa-l *...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8088 ==
+
== Metabolite CPD-381 ==
 
* common-name:
 
* common-name:
** 1-linoleoyl-2-oleoyl-phosphatidylcholine
+
** (s)-2-hydroxyglutarate
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** c(=o)([o-])c(o)ccc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** rtazwrzkfstmoy-nmsvecgzsa-n
+
** hwxbtnavrsuojr-vkhmyheasa-l
 
* molecular-weight:
 
* molecular-weight:
** 784.107
+
** 146.099
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8321]]
+
* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
* [[RXN-8328]]
+
* [[RXN-16701]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8320]]
+
* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
 +
* [[RXN-16701]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-linoleoyl-2-oleoyl-phosphatidylcholine}}
+
{{#set: common-name=(s)-2-hydroxyglutarate}}
{{#set: inchi-key=inchikey=rtazwrzkfstmoy-nmsvecgzsa-n}}
+
{{#set: inchi-key=inchikey=hwxbtnavrsuojr-vkhmyheasa-l}}
{{#set: molecular-weight=784.107}}
+
{{#set: molecular-weight=146.099}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-381

  • common-name:
    • (s)-2-hydroxyglutarate
  • smiles:
    • c(=o)([o-])c(o)ccc(=o)[o-]
  • inchi-key:
    • hwxbtnavrsuojr-vkhmyheasa-l
  • molecular-weight:
    • 146.099

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality