Difference between revisions of "CPD-381"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07667 == * transcription-direction: ** positive * right-end-position: ** 234285 * left-end-position: ** 221644 * centisome-position: ** 49.4021...") |
(Created page with "Category:metabolite == Metabolite CPD-381 == * common-name: ** (s)-2-hydroxyglutarate * smiles: ** c(=o)([o-])c(o)ccc(=o)[o-] * inchi-key: ** hwxbtnavrsuojr-vkhmyheasa-l *...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-381 == |
− | * | + | * common-name: |
− | ** | + | ** (s)-2-hydroxyglutarate |
− | * | + | * smiles: |
− | ** | + | ** c(=o)([o-])c(o)ccc(=o)[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** hwxbtnavrsuojr-vkhmyheasa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 146.099 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]] |
− | == Reaction(s) | + | * [[RXN-16701]] |
− | * [[RXN | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]] |
− | + | * [[RXN-16701]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=(s)-2-hydroxyglutarate}} | |
− | + | {{#set: inchi-key=inchikey=hwxbtnavrsuojr-vkhmyheasa-l}} | |
− | {{#set: | + | {{#set: molecular-weight=146.099}} |
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-381
- common-name:
- (s)-2-hydroxyglutarate
- smiles:
- c(=o)([o-])c(o)ccc(=o)[o-]
- inchi-key:
- hwxbtnavrsuojr-vkhmyheasa-l
- molecular-weight:
- 146.099